prop-src/options.cc

   1 ///////////////////////////////////////////////////////////////////////////////
   2 //
   3 //  This file implements the options selected during translation.
   4 //
   5 ///////////////////////////////////////////////////////////////////////////////
   6 #include <string.h>
   7 #include <iostream>
   8 #include "basics.h"
   9 #include "config.h"
  10 #include "options.h"
  11
  12 ///////////////////////////////////////////////////////////////////////////////
  13 //
  14 //  Default setting of the prop options
  15 //
  16 ///////////////////////////////////////////////////////////////////////////////
  17 PropOptions::PropOptions()
  18 {
  19    debug               = false;
  20    emit_code           = true;
  21    strict_checking     = false;
  22    line_directives     = true;
  23    trace               = false;
  24    nonlinear_patterns  = false;
  25    merge_match         = true;
  26    generate_report     = false;
  27    burs                = false;
  28    fast_string_match   = false;
  29    adaptive_matching   = false;
  30    inline_casts        = false;
  31    save_space          = false;
  32    tagged_pointer      = false;
  33    GNU_style_message   = false;
  34    new_type_format     = true;
  35    gen_dependences     = false;
  36    new_list_format     = false;
  37    max_vector_len      = MAX_VECTOR_LEN;
  38    verbosity           = 0;
  39    optimization_level  = 0;
  40    max_embedded_tags   = 4;
  41    input_file_name     = 0;
  42    to_stdout           = false;
  43    file_count          = 0;
  44    automake            = false;
  45    option_count        = 0;
  46    visualization       = false;
  47    generate_html       = false;
  48    optimize_rewrite    = false;
  49    strcpy(search_paths,DEFAULT_SEARCH_PATH);
  50 }
  51 PropOptions::~PropOptions() {}
  52
  53 ///////////////////////////////////////////////////////////////////////////////
  54 //
  55 //  Features used are described by the following structure.  We generate
  56 //  code so that only the features actually used are emitted.  We'll keep
  57 //  track of which features are actually used in this structure.
  58 //
  59 ///////////////////////////////////////////////////////////////////////////////
  60 Bool Used::rewriting    = false;
  61 Bool Used::infer        = false;
  62 Bool Used::gc           = false;
  63 Bool Used::regexp       = false;
  64 Bool Used::string_match = false;
  65 Bool Used::printer      = false;
  66 Bool Used::refcount     = false;
  67 Bool Used::persistence  = false;
  68 Bool Used::objc         = false;
  69 Bool Used::equality     = false;
  70 Bool Used::unification  = false;
  71 Bool Used::vector       = false;
  72 Bool Used::parser       = false;
  73 Bool Used::quark        = false;
  74 Bool Used::bigint       = false;
  75 Bool Used::graph_type   = false;
  76 static Bool tuple_used[MAX_TUPLE_ARITY];
  77 Bool * Used::tuple = tuple_used;
  78
  79 IncludeDependency * IncludeDependency::dependences = 0;
  80
  81 ///////////////////////////////////////////////////////////////////////////////
  82 //
  83 //  Add a file to the dependency list
  84 //
  85 ///////////////////////////////////////////////////////////////////////////////
  86 void IncludeDependency::add_dependency (const char * file)
  87 {  dependences = new IncludeDependency (file, dependences);
  88 }
  89
  90 ///////////////////////////////////////////////////////////////////////////////
  91 //
  92 //  Print the dependences
  93 //
  94 ///////////////////////////////////////////////////////////////////////////////
  95 void IncludeDependency::print_dependences ()
  96 {  std::cout << options.output_file_name << ":\t" << options.input_file_name << ' ';
  97    int len = strlen(options.output_file_name) + 10 + strlen(options.input_file_name);
  98    IncludeDependency * d;
  99    for (d = dependences; d; d = d->next)
 100    {  const char * file_name = d->file_name;
 101       if (file_name[0] == '.' && file_name[1] == PATH_SEPARATOR)
 102           file_name += 2;
 103       int this_len = strlen(file_name);
 104       if (this_len + len >= 79) { len = 8; std::cout << "\\\n\t"; }
 105       std::cout << file_name << ' ';
 106       len += this_len + 1;
 107    }
 108    std::cout << '\n';
 109 }